C22H24N4O3S — CID 95806366
N-[(1S)-6-[3-(1H-pyrazol-4-yl)propylsulfamoyl]-2,3-dihydro-1H-inden-1-yl]benzamide (PubChem CID 95806366) has the molecular formula C22H24N4O3S and a molecular weight of 424.53 g/mol. Its IUPAC name is N-[(1S)-6-[3-(1H-pyrazol-4-yl)propylsulfamoyl]-2,3-dihydro-1H-inden-1-yl]benzamide.
| Compound Name | N-[(1S)-6-[3-(1H-pyrazol-4-yl)propylsulfamoyl]-2,3-dihydro-1H-inden-1-yl]benzamide |
|---|---|
| PubChem CID | 95806366 |
| Molecular Formula | C22H24N4O3S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | N-[(1S)-6-[3-(1H-pyrazol-4-yl)propylsulfamoyl]-2,3-dihydro-1H-inden-1-yl]benzamide |
| SMILES | O=C(N[C@H]1CCc2ccc(S(=O)(=O)NCCCc3cn[nH]c3)cc21)c1ccccc1 |
| InChI | InChI=1S/C22H24N4O3S/c27-22(18-6-2-1-3-7-18)26-21-11-9-17-8-10-19(13-20(17)21)30(28,29)25-12-4-5-16-14-23-24-15-16/h1-3,6-8,10,13-15,21,25H,4-5,9,11-12H2,(H,23,24)(H,26,27)/t21-/m0/s1 |
| InChIKey | VPHPQGYBTKDWTJ-NRFANRHFSA-N |
| XLogP | 2.74 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|