C25H28N4O4 — CID 95811682
5,5-dimethyl-3-[3-oxo-3-[(2S)-3-oxo-2-[(4-phenylphenyl)methyl]piperazin-1-yl]propyl]imidazolidine-2,4-dione (PubChem CID 95811682) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is 5,5-dimethyl-3-[3-oxo-3-[(2S)-3-oxo-2-[(4-phenylphenyl)methyl]piperazin-1-yl]propyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[3-oxo-3-[(2S)-3-oxo-2-[(4-phenylphenyl)methyl]piperazin-1-yl]propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95811682 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 5,5-dimethyl-3-[3-oxo-3-[(2S)-3-oxo-2-[(4-phenylphenyl)methyl]piperazin-1-yl]propyl]imidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CCC(=O)N2CCNC(=O)[C@@H]2Cc2ccc(-c3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C25H28N4O4/c1-25(2)23(32)29(24(33)27-25)14-12-21(30)28-15-13-26-22(31)20(28)16-17-8-10-19(11-9-17)18-6-4-3-5-7-18/h3-11,20H,12-16H2,1-2H3,(H,26,31)(H,27,33)/t20-/m0/s1 |
| InChIKey | KGMJJTBUPAVXPN-FQEVSTJZSA-N |
| XLogP | 1.94 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|