C16H20N4O2S — CID 95847201
6-[[(3R)-1-(benzenesulfonyl)piperidin-3-yl]methyl]pyridazin-3-amine (PubChem CID 95847201) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is 6-[[(3R)-1-(benzenesulfonyl)piperidin-3-yl]methyl]pyridazin-3-amine.
| Compound Name | 6-[[(3R)-1-(benzenesulfonyl)piperidin-3-yl]methyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 95847201 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 6-[[(3R)-1-(benzenesulfonyl)piperidin-3-yl]methyl]pyridazin-3-amine |
| SMILES | Nc1ccc(C[C@H]2CCCN(S(=O)(=O)c3ccccc3)C2)nn1 |
| InChI | InChI=1S/C16H20N4O2S/c17-16-9-8-14(18-19-16)11-13-5-4-10-20(12-13)23(21,22)15-6-2-1-3-7-15/h1-3,6-9,13H,4-5,10-12H2,(H2,17,19)/t13-/m1/s1 |
| InChIKey | QRCANIDHURSWDK-CYBMUJFWSA-N |
| XLogP | 1.70 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |