C14H15ClN2O2 — CID 95934284
(2R)-2-(4-chlorophenoxy)-N-(1H-pyrrol-2-ylmethyl)propanamide (PubChem CID 95934284) has the molecular formula C14H15ClN2O2 and a molecular weight of 278.74 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenoxy)-N-(1H-pyrrol-2-ylmethyl)propanamide.
| Compound Name | (2R)-2-(4-chlorophenoxy)-N-(1H-pyrrol-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 95934284 |
| Molecular Formula | C14H15ClN2O2 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | (2R)-2-(4-chlorophenoxy)-N-(1H-pyrrol-2-ylmethyl)propanamide |
| SMILES | C[C@@H](Oc1ccc(Cl)cc1)C(=O)NCc1ccc[nH]1 |
| InChI | InChI=1S/C14H15ClN2O2/c1-10(19-13-6-4-11(15)5-7-13)14(18)17-9-12-3-2-8-16-12/h2-8,10,16H,9H2,1H3,(H,17,18)/t10-/m1/s1 |
| InChIKey | FFELHMXYYGBKTJ-SNVBAGLBSA-N |
| XLogP | 2.75 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |