C18H17N3O2 — CID 95947957
2-[(5-amino-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile (PubChem CID 95947957) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-[(5-amino-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile.
| Compound Name | 2-[(5-amino-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 95947957 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2-[(5-amino-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile |
| SMILES | CC1(C)Oc2cccc(N)c2N(Cc2ccccc2C#N)C1=O |
| InChI | InChI=1S/C18H17N3O2/c1-18(2)17(22)21(11-13-7-4-3-6-12(13)10-19)16-14(20)8-5-9-15(16)23-18/h3-9H,11,20H2,1-2H3 |
| InChIKey | VTBSWGTVXZSEPE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 79.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|