C12H15N5O3S — CID 959503
ethyl 2,4-dimethyl-5-(1H-1,2,4-triazol-5-ylsulfanylcarbonylamino)-1H-pyrrole-3-carboxylate (PubChem CID 959503) has the molecular formula C12H15N5O3S and a molecular weight of 309.35 g/mol. Its IUPAC name is ethyl 2,4-dimethyl-5-(1H-1,2,4-triazol-5-ylsulfanylcarbonylamino)-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 2,4-dimethyl-5-(1H-1,2,4-triazol-5-ylsulfanylcarbonylamino)-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 959503 |
| Molecular Formula | C12H15N5O3S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | ethyl 2,4-dimethyl-5-(1H-1,2,4-triazol-5-ylsulfanylcarbonylamino)-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(NC(=O)Sc2ncn[nH]2)c1C |
| InChI | InChI=1S/C12H15N5O3S/c1-4-20-10(18)8-6(2)9(15-7(8)3)16-12(19)21-11-13-5-14-17-11/h5,15H,4H2,1-3H3,(H,16,19)(H,13,14,17) |
| InChIKey | HOKHBDXZSGYWMZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|