C18H22N2O3 — CID 95980444
[(5aS,8aR)-2,3,4,5a,6,7,8,8a-octahydrocyclopenta[b][1,4]oxazepin-5-yl]-[(5S)-5-phenyl-4,5-dihydro-1,2-oxazol-3-yl]methanone (PubChem CID 95980444) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is [(5aS,8aR)-2,3,4,5a,6,7,8,8a-octahydrocyclopenta[b][1,4]oxazepin-5-yl]-[(5S)-5-phenyl-4,5-dihydro-1,2-oxazol-3-yl]methanone.
| Compound Name | [(5aS,8aR)-2,3,4,5a,6,7,8,8a-octahydrocyclopenta[b][1,4]oxazepin-5-yl]-[(5S)-5-phenyl-4,5-dihydro-1,2-oxazol-3-yl]methanone |
|---|---|
| PubChem CID | 95980444 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | [(5aS,8aR)-2,3,4,5a,6,7,8,8a-octahydrocyclopenta[b][1,4]oxazepin-5-yl]-[(5S)-5-phenyl-4,5-dihydro-1,2-oxazol-3-yl]methanone |
| SMILES | O=C(C1=NO[C@H](c2ccccc2)C1)N1CCCO[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C18H22N2O3/c21-18(20-10-5-11-22-16-9-4-8-15(16)20)14-12-17(23-19-14)13-6-2-1-3-7-13/h1-3,6-7,15-17H,4-5,8-12H2/t15-,16+,17-/m0/s1 |
| InChIKey | INDUEYXUNTXQRK-BBWFWOEESA-N |
| XLogP | 2.67 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |