C18H21FN4OS — CID 95989208
2-[4-(4-fluorophenyl)piperazin-1-yl]-N-[(Z)-1-thiophen-2-ylethylideneamino]acetamide (PubChem CID 95989208) has the molecular formula C18H21FN4OS and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)piperazin-1-yl]-N-[(Z)-1-thiophen-2-ylethylideneamino]acetamide.
| Compound Name | 2-[4-(4-fluorophenyl)piperazin-1-yl]-N-[(Z)-1-thiophen-2-ylethylideneamino]acetamide |
|---|---|
| PubChem CID | 95989208 |
| Molecular Formula | C18H21FN4OS |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 2-[4-(4-fluorophenyl)piperazin-1-yl]-N-[(Z)-1-thiophen-2-ylethylideneamino]acetamide |
| SMILES | C/C(=N/NC(=O)CN1CCN(c2ccc(F)cc2)CC1)c1cccs1 |
| InChI | InChI=1S/C18H21FN4OS/c1-14(17-3-2-12-25-17)20-21-18(24)13-22-8-10-23(11-9-22)16-6-4-15(19)5-7-16/h2-7,12H,8-11,13H2,1H3,(H,21,24)/b20-14- |
| InChIKey | APGCJVRABLHUJE-ZHZULCJRSA-N |
| XLogP | 2.55 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|