C18H27N3O2 — CID 96517982
1-[[(1S,2S)-2-hydroxycyclopentyl]methyl]-3-(3-methyl-4-pyrrolidin-1-ylphenyl)urea (PubChem CID 96517982) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 1-[[(1S,2S)-2-hydroxycyclopentyl]methyl]-3-(3-methyl-4-pyrrolidin-1-ylphenyl)urea.
| Compound Name | 1-[[(1S,2S)-2-hydroxycyclopentyl]methyl]-3-(3-methyl-4-pyrrolidin-1-ylphenyl)urea |
|---|---|
| PubChem CID | 96517982 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 1-[[(1S,2S)-2-hydroxycyclopentyl]methyl]-3-(3-methyl-4-pyrrolidin-1-ylphenyl)urea |
| SMILES | Cc1cc(NC(=O)NC[C@@H]2CCC[C@@H]2O)ccc1N1CCCC1 |
| InChI | InChI=1S/C18H27N3O2/c1-13-11-15(7-8-16(13)21-9-2-3-10-21)20-18(23)19-12-14-5-4-6-17(14)22/h7-8,11,14,17,22H,2-6,9-10,12H2,1H3,(H2,19,20,23)/t14-,17-/m0/s1 |
| InChIKey | ZWZDDZQELDEXEF-YOEHRIQHSA-N |
| XLogP | 2.88 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|