C15H19NO4S — CID 96521359
3-methoxy-N-[(1S,3R)-1-oxothiolan-3-yl]-4-prop-2-enoxybenzamide (PubChem CID 96521359) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is 3-methoxy-N-[(1S,3R)-1-oxothiolan-3-yl]-4-prop-2-enoxybenzamide.
| Compound Name | 3-methoxy-N-[(1S,3R)-1-oxothiolan-3-yl]-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 96521359 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 3-methoxy-N-[(1S,3R)-1-oxothiolan-3-yl]-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)N[C@@H]2CC[S@@](=O)C2)cc1OC |
| InChI | InChI=1S/C15H19NO4S/c1-3-7-20-13-5-4-11(9-14(13)19-2)15(17)16-12-6-8-21(18)10-12/h3-5,9,12H,1,6-8,10H2,2H3,(H,16,17)/t12-,21-/m1/s1 |
| InChIKey | YTOLGNRLOWMFLJ-XUSGNXJCSA-N |
| XLogP | 1.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|