C24H22FNO3 — CID 96525444
2-benzoyl-N-[(2R)-2-[(4-fluorophenyl)methyl]-3-hydroxypropyl]benzamide (PubChem CID 96525444) has the molecular formula C24H22FNO3 and a molecular weight of 391.44 g/mol. Its IUPAC name is 2-benzoyl-N-[(2R)-2-[(4-fluorophenyl)methyl]-3-hydroxypropyl]benzamide.
| Compound Name | 2-benzoyl-N-[(2R)-2-[(4-fluorophenyl)methyl]-3-hydroxypropyl]benzamide |
|---|---|
| PubChem CID | 96525444 |
| Molecular Formula | C24H22FNO3 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 2-benzoyl-N-[(2R)-2-[(4-fluorophenyl)methyl]-3-hydroxypropyl]benzamide |
| SMILES | O=C(NC[C@H](CO)Cc1ccc(F)cc1)c1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H22FNO3/c25-20-12-10-17(11-13-20)14-18(16-27)15-26-24(29)22-9-5-4-8-21(22)23(28)19-6-2-1-3-7-19/h1-13,18,27H,14-16H2,(H,26,29)/t18-/m1/s1 |
| InChIKey | PDXCPJTXFOSGQG-GOSISDBHSA-N |
| XLogP | 3.64 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |