C13H16N4O5S — CID 96533482
(8aR)-7-(4-methyl-2-nitrophenyl)sulfonyl-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 96533482) has the molecular formula C13H16N4O5S and a molecular weight of 340.36 g/mol. Its IUPAC name is (8aR)-7-(4-methyl-2-nitrophenyl)sulfonyl-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | (8aR)-7-(4-methyl-2-nitrophenyl)sulfonyl-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 96533482 |
| Molecular Formula | C13H16N4O5S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | (8aR)-7-(4-methyl-2-nitrophenyl)sulfonyl-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN3C(=O)NC[C@@H]3C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H16N4O5S/c1-9-2-3-12(11(6-9)17(19)20)23(21,22)15-4-5-16-10(8-15)7-14-13(16)18/h2-3,6,10H,4-5,7-8H2,1H3,(H,14,18)/t10-/m1/s1 |
| InChIKey | LXSQMLDVUNZPBS-SNVBAGLBSA-N |
| XLogP | 0.30 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|