C13H23ClN2O2 — CID 96554492
N-[(1S,2S)-2-[acetyl(propan-2-yl)amino]cyclohexyl]-2-chloroacetamide (PubChem CID 96554492) has the molecular formula C13H23ClN2O2 and a molecular weight of 274.79 g/mol. Its IUPAC name is N-[(1S,2S)-2-[acetyl(propan-2-yl)amino]cyclohexyl]-2-chloroacetamide.
| Compound Name | N-[(1S,2S)-2-[acetyl(propan-2-yl)amino]cyclohexyl]-2-chloroacetamide |
|---|---|
| PubChem CID | 96554492 |
| Molecular Formula | C13H23ClN2O2 |
| Molecular Weight | 274.79 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | N-[(1S,2S)-2-[acetyl(propan-2-yl)amino]cyclohexyl]-2-chloroacetamide |
| SMILES | CC(=O)N(C(C)C)[C@H]1CCCC[C@@H]1NC(=O)CCl |
| InChI | InChI=1S/C13H23ClN2O2/c1-9(2)16(10(3)17)12-7-5-4-6-11(12)15-13(18)8-14/h9,11-12H,4-8H2,1-3H3,(H,15,18)/t11-,12-/m0/s1 |
| InChIKey | SWZKQRZUBOTOCY-RYUDHWBXSA-N |
| XLogP | 1.91 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.79 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|