C12H12Cl2O3 — CID 96561046
(2S,3R)-2-(2,4-dichlorophenyl)oxane-3-carboxylic acid (PubChem CID 96561046) has the molecular formula C12H12Cl2O3 and a molecular weight of 275.13 g/mol. Its IUPAC name is (2S,3R)-2-(2,4-dichlorophenyl)oxane-3-carboxylic acid.
| Compound Name | (2S,3R)-2-(2,4-dichlorophenyl)oxane-3-carboxylic acid |
|---|---|
| PubChem CID | 96561046 |
| Molecular Formula | C12H12Cl2O3 |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | (2S,3R)-2-(2,4-dichlorophenyl)oxane-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCO[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H12Cl2O3/c13-7-3-4-8(10(14)6-7)11-9(12(15)16)2-1-5-17-11/h3-4,6,9,11H,1-2,5H2,(H,15,16)/t9-,11-/m1/s1 |
| InChIKey | SUHSOPNQXDUJFM-MWLCHTKSSA-N |
| XLogP | 3.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |