C19H22Cl2N2O3 — CID 99783245
[1-(cyanomethyl)piperidin-4-yl] (2S,3S)-2-(2,4-dichlorophenyl)oxane-3-carboxylate (PubChem CID 99783245) has the molecular formula C19H22Cl2N2O3 and a molecular weight of 397.30 g/mol. Its IUPAC name is [1-(cyanomethyl)piperidin-4-yl] (2S,3S)-2-(2,4-dichlorophenyl)oxane-3-carboxylate.
| Compound Name | [1-(cyanomethyl)piperidin-4-yl] (2S,3S)-2-(2,4-dichlorophenyl)oxane-3-carboxylate |
|---|---|
| PubChem CID | 99783245 |
| Molecular Formula | C19H22Cl2N2O3 |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | [1-(cyanomethyl)piperidin-4-yl] (2S,3S)-2-(2,4-dichlorophenyl)oxane-3-carboxylate |
| SMILES | N#CCN1CCC(OC(=O)[C@H]2CCCO[C@@H]2c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C19H22Cl2N2O3/c20-13-3-4-15(17(21)12-13)18-16(2-1-11-25-18)19(24)26-14-5-8-23(9-6-14)10-7-22/h3-4,12,14,16,18H,1-2,5-6,8-11H2/t16-,18+/m0/s1 |
| InChIKey | HGHBEIQSGQZLEH-FUHWJXTLSA-N |
| XLogP | 3.99 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|