C5H7NO2 — CID 96563207
(3S,4S)-4-hydroxyoxolane-3-carbonitrile (PubChem CID 96563207) has the molecular formula C5H7NO2 and a molecular weight of 113.12 g/mol. Its IUPAC name is (3S,4S)-4-hydroxyoxolane-3-carbonitrile.
| Compound Name | (3S,4S)-4-hydroxyoxolane-3-carbonitrile |
|---|---|
| PubChem CID | 96563207 |
| Molecular Formula | C5H7NO2 |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.05 |
| IUPAC Name | (3S,4S)-4-hydroxyoxolane-3-carbonitrile |
| SMILES | N#C[C@H]1COC[C@H]1O |
| InChI | InChI=1S/C5H7NO2/c6-1-4-2-8-3-5(4)7/h4-5,7H,2-3H2/t4-,5+/m0/s1 |
| InChIKey | KZVPMNPHZILVPO-CRCLSJGQSA-N |
| XLogP | -0.48 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |