About (2S)-2-amino-2-imidazo[5,1-b][1,3]thiazol-5-ylethanol
(2S)-2-amino-2-imidazo[5,1-b][1,3]thiazol-5-ylethanol (PubChem CID 96563238) has the molecular formula C7H9N3OS
and a molecular weight of 183.24 g/mol. Its IUPAC name is (2S)-2-amino-2-imidazo[5,1-b][1,3]thiazol-5-ylethanol.
Analyze (2S)-2-amino-2-imidazo[5,1-b][1,3]thiazol-5-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-2-imidazo[5,1-b][1,3]thiazol-5-ylethanol?
The IUPAC name of (2S)-2-amino-2-imidazo[5,1-b][1,3]thiazol-5-ylethanol (CID 96563238) is (2S)-2-amino-2-imidazo[5,1-b][1,3]thiazol-5-ylethanol.
What is the SMILES notation for (2S)-2-amino-2-imidazo[5,1-b][1,3]thiazol-5-ylethanol?
The canonical SMILES for (2S)-2-amino-2-imidazo[5,1-b][1,3]thiazol-5-ylethanol is N[C@H](CO)c1ncc2sccn12.
What is the InChIKey of (2S)-2-amino-2-imidazo[5,1-b][1,3]thiazol-5-ylethanol?
The InChIKey is SILJUQXXYZFWRT-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H9N3OS/c8-5(4-11)7-9-3-6-10(7)1-2-12-6/h1-3,5,11H,4,8H2/t5-/m1/s1.
What are the key properties of (2S)-2-amino-2-imidazo[5,1-b][1,3]thiazol-5-ylethanol?
(2S)-2-amino-2-imidazo[5,1-b][1,3]thiazol-5-ylethanol has a molecular weight of 183.24 g/mol, XLogP of 0.39, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-2-imidazo[5,1-b][1,3]thiazol-5-ylethanol is sourced from PubChem (CID 96563238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).