C17H20N6O — CID 96563243
6-[(3R)-3-(3-phenylpropoxy)pyrrolidin-1-yl]tetrazolo[1,5-b]pyridazine (PubChem CID 96563243) has the molecular formula C17H20N6O and a molecular weight of 324.39 g/mol. Its IUPAC name is 6-[(3R)-3-(3-phenylpropoxy)pyrrolidin-1-yl]tetrazolo[1,5-b]pyridazine.
| Compound Name | 6-[(3R)-3-(3-phenylpropoxy)pyrrolidin-1-yl]tetrazolo[1,5-b]pyridazine |
|---|---|
| PubChem CID | 96563243 |
| Molecular Formula | C17H20N6O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 6-[(3R)-3-(3-phenylpropoxy)pyrrolidin-1-yl]tetrazolo[1,5-b]pyridazine |
| SMILES | c1ccc(CCCO[C@@H]2CCN(c3ccc4nnnn4n3)C2)cc1 |
| InChI | InChI=1S/C17H20N6O/c1-2-5-14(6-3-1)7-4-12-24-15-10-11-22(13-15)17-9-8-16-18-20-21-23(16)19-17/h1-3,5-6,8-9,15H,4,7,10-13H2/t15-/m1/s1 |
| InChIKey | WBUKYQLHDDOISW-OAHLLOKOSA-N |
| XLogP | 1.75 |
| TPSA | 68.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|