C23H25N3O2 — CID 96571413
(5R)-4-(3-ethyl-1H-indole-2-carbonyl)-5-methyl-1-(4-methylphenyl)piperazin-2-one (PubChem CID 96571413) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is (5R)-4-(3-ethyl-1H-indole-2-carbonyl)-5-methyl-1-(4-methylphenyl)piperazin-2-one.
| Compound Name | (5R)-4-(3-ethyl-1H-indole-2-carbonyl)-5-methyl-1-(4-methylphenyl)piperazin-2-one |
|---|---|
| PubChem CID | 96571413 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | (5R)-4-(3-ethyl-1H-indole-2-carbonyl)-5-methyl-1-(4-methylphenyl)piperazin-2-one |
| SMILES | CCc1c(C(=O)N2CC(=O)N(c3ccc(C)cc3)C[C@H]2C)[nH]c2ccccc12 |
| InChI | InChI=1S/C23H25N3O2/c1-4-18-19-7-5-6-8-20(19)24-22(18)23(28)25-14-21(27)26(13-16(25)3)17-11-9-15(2)10-12-17/h5-12,16,24H,4,13-14H2,1-3H3/t16-/m1/s1 |
| InChIKey | DKHJCZYNMKGBTO-MRXNPFEDSA-N |
| XLogP | 3.92 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|