C18H26N2O2S — CID 96572481
1-[4-(2-methylphenyl)sulfanylpiperidin-1-yl]-2-[(3R)-morpholin-3-yl]ethanone (PubChem CID 96572481) has the molecular formula C18H26N2O2S and a molecular weight of 334.48 g/mol. Its IUPAC name is 1-[4-(2-methylphenyl)sulfanylpiperidin-1-yl]-2-[(3R)-morpholin-3-yl]ethanone.
| Compound Name | 1-[4-(2-methylphenyl)sulfanylpiperidin-1-yl]-2-[(3R)-morpholin-3-yl]ethanone |
|---|---|
| PubChem CID | 96572481 |
| Molecular Formula | C18H26N2O2S |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 1-[4-(2-methylphenyl)sulfanylpiperidin-1-yl]-2-[(3R)-morpholin-3-yl]ethanone |
| SMILES | Cc1ccccc1SC1CCN(C(=O)C[C@@H]2COCCN2)CC1 |
| InChI | InChI=1S/C18H26N2O2S/c1-14-4-2-3-5-17(14)23-16-6-9-20(10-7-16)18(21)12-15-13-22-11-8-19-15/h2-5,15-16,19H,6-13H2,1H3/t15-/m1/s1 |
| InChIKey | LLLYFDJEYJZTER-OAHLLOKOSA-N |
| XLogP | 2.46 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |