C9H13N3O4 — CID 96602911
3-[carbamoyl(1,3-oxazol-5-yl)amino]-3-methylbutanoic acid (PubChem CID 96602911) has the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. Its IUPAC name is 3-[carbamoyl(1,3-oxazol-5-yl)amino]-3-methylbutanoic acid.
| Compound Name | 3-[carbamoyl(1,3-oxazol-5-yl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 96602911 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 3-[carbamoyl(1,3-oxazol-5-yl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)(CC(=O)O)N(C(N)=O)c1cnco1 |
| InChI | InChI=1S/C9H13N3O4/c1-9(2,3-7(13)14)12(8(10)15)6-4-11-5-16-6/h4-5H,3H2,1-2H3,(H2,10,15)(H,13,14) |
| InChIKey | XDSCQDNQGDWHNI-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |