C7H10N2O3 — CID 82598143
4-amino-4-(1,3-oxazol-5-yl)butanoic acid (PubChem CID 82598143) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is 4-amino-4-(1,3-oxazol-5-yl)butanoic acid.
| Compound Name | 4-amino-4-(1,3-oxazol-5-yl)butanoic acid |
|---|---|
| PubChem CID | 82598143 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 4-amino-4-(1,3-oxazol-5-yl)butanoic acid |
| SMILES | NC(CCC(=O)O)c1cnco1 |
| InChI | InChI=1S/C7H10N2O3/c8-5(1-2-7(10)11)6-3-9-4-12-6/h3-5H,1-2,8H2,(H,10,11) |
| InChIKey | YYZBCYIJJPEQNR-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |