C11H9NO3 — CID 96619137
5,6-dihydro-4H-furo[2,3-e]indole-2-carboxylic acid (PubChem CID 96619137) has the molecular formula C11H9NO3 and a molecular weight of 203.20 g/mol. Its IUPAC name is 5,6-dihydro-4H-furo[2,3-e]indole-2-carboxylic acid.
| Compound Name | 5,6-dihydro-4H-furo[2,3-e]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 96619137 |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 5,6-dihydro-4H-furo[2,3-e]indole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2c(o1)-c1cc[nH]c1CC2 |
| InChI | InChI=1S/C11H9NO3/c13-11(14)9-5-6-1-2-8-7(3-4-12-8)10(6)15-9/h3-5,12H,1-2H2,(H,13,14) |
| InChIKey | WSQSYXLLZVSUDL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |