5,6-dihydro-4H-furo[2,3-e]indole-2-carboxylic acid

C11H9NO3 — CID 96619137

IUPAC5,6-dihydro-4H-furo[2,3-e]indole-2-carboxylic acid
SMILESO=C(O)c1cc2c(o1)-c1cc[nH]c1CC2
InChIInChI=1S/C11H9NO3/c13-11(14)9-5-6-1-2-8-7(3-4-12-8)10(6)15-9/h3-5,12H,1-2H2,(H,13,14)
InChIKeyWSQSYXLLZVSUDL-UHFFFAOYSA-N
MW203.20 g/mol
LogP2.07
Rot. Bonds1

About 5,6-dihydro-4H-furo[2,3-e]indole-2-carboxylic acid

5,6-dihydro-4H-furo[2,3-e]indole-2-carboxylic acid (PubChem CID 96619137) has the molecular formula C11H9NO3 and a molecular weight of 203.20 g/mol. Its IUPAC name is 5,6-dihydro-4H-furo[2,3-e]indole-2-carboxylic acid.

Molecular Properties

Compound Name5,6-dihydro-4H-furo[2,3-e]indole-2-carboxylic acid
PubChem CID96619137
Molecular FormulaC11H9NO3
Molecular Weight203.20 g/mol
Exact Mass203.06
IUPAC Name5,6-dihydro-4H-furo[2,3-e]indole-2-carboxylic acid
SMILESO=C(O)c1cc2c(o1)-c1cc[nH]c1CC2
InChIInChI=1S/C11H9NO3/c13-11(14)9-5-6-1-2-8-7(3-4-12-8)10(6)15-9/h3-5,12H,1-2H2,(H,13,14)
InChIKeyWSQSYXLLZVSUDL-UHFFFAOYSA-N
XLogP2.07
TPSA66.23 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.20
LogP ≤ 52.07
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 5,6-dihydro-4H-furo[2,3-e]indole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,6-dihydro-4H-furo[2,3-e]indole-2-carboxylic acid?
The IUPAC name of 5,6-dihydro-4H-furo[2,3-e]indole-2-carboxylic acid (CID 96619137) is 5,6-dihydro-4H-furo[2,3-e]indole-2-carboxylic acid.
What is the SMILES notation for 5,6-dihydro-4H-furo[2,3-e]indole-2-carboxylic acid?
The canonical SMILES for 5,6-dihydro-4H-furo[2,3-e]indole-2-carboxylic acid is O=C(O)c1cc2c(o1)-c1cc[nH]c1CC2.
What is the InChIKey of 5,6-dihydro-4H-furo[2,3-e]indole-2-carboxylic acid?
The InChIKey is WSQSYXLLZVSUDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO3/c13-11(14)9-5-6-1-2-8-7(3-4-12-8)10(6)15-9/h3-5,12H,1-2H2,(H,13,14).
What are the key properties of 5,6-dihydro-4H-furo[2,3-e]indole-2-carboxylic acid?
5,6-dihydro-4H-furo[2,3-e]indole-2-carboxylic acid has a molecular weight of 203.20 g/mol, XLogP of 2.07, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydro-4H-furo[2,3-e]indole-2-carboxylic acid is sourced from PubChem (CID 96619137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).