C14H15N3O2 — CID 129246616
anilino 1,4,5,7-tetrahydropyrrolo[2,3-c]pyridine-6-carboxylate (PubChem CID 129246616) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is anilino 1,4,5,7-tetrahydropyrrolo[2,3-c]pyridine-6-carboxylate.
| Compound Name | anilino 1,4,5,7-tetrahydropyrrolo[2,3-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 129246616 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | anilino 1,4,5,7-tetrahydropyrrolo[2,3-c]pyridine-6-carboxylate |
| SMILES | O=C(ONc1ccccc1)N1CCc2cc[nH]c2C1 |
| InChI | InChI=1S/C14H15N3O2/c18-14(19-16-12-4-2-1-3-5-12)17-9-7-11-6-8-15-13(11)10-17/h1-6,8,15-16H,7,9-10H2 |
| InChIKey | AHMDUBLIVVBXMH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|