About (1S)-1-(1-methyl-1,2,4-triazol-3-yl)propan-1-amine
(1S)-1-(1-methyl-1,2,4-triazol-3-yl)propan-1-amine (PubChem CID 96637208) has the molecular formula C6H12N4
and a molecular weight of 140.19 g/mol. Its IUPAC name is (1S)-1-(1-methyl-1,2,4-triazol-3-yl)propan-1-amine.
Analyze (1S)-1-(1-methyl-1,2,4-triazol-3-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(1-methyl-1,2,4-triazol-3-yl)propan-1-amine?
The IUPAC name of (1S)-1-(1-methyl-1,2,4-triazol-3-yl)propan-1-amine (CID 96637208) is (1S)-1-(1-methyl-1,2,4-triazol-3-yl)propan-1-amine.
What is the SMILES notation for (1S)-1-(1-methyl-1,2,4-triazol-3-yl)propan-1-amine?
The canonical SMILES for (1S)-1-(1-methyl-1,2,4-triazol-3-yl)propan-1-amine is CC[C@H](N)c1ncn(C)n1.
What is the InChIKey of (1S)-1-(1-methyl-1,2,4-triazol-3-yl)propan-1-amine?
The InChIKey is USRLURUFRDKPEX-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H12N4/c1-3-5(7)6-8-4-10(2)9-6/h4-5H,3,7H2,1-2H3/t5-/m0/s1.
What are the key properties of (1S)-1-(1-methyl-1,2,4-triazol-3-yl)propan-1-amine?
(1S)-1-(1-methyl-1,2,4-triazol-3-yl)propan-1-amine has a molecular weight of 140.19 g/mol, XLogP of 0.22, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(1-methyl-1,2,4-triazol-3-yl)propan-1-amine is sourced from PubChem (CID 96637208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).