C7H12N2O — CID 96637265
(1R)-1-(5-methyl-1,3-oxazol-2-yl)propan-1-amine (PubChem CID 96637265) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is (1R)-1-(5-methyl-1,3-oxazol-2-yl)propan-1-amine.
| Compound Name | (1R)-1-(5-methyl-1,3-oxazol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 96637265 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | (1R)-1-(5-methyl-1,3-oxazol-2-yl)propan-1-amine |
| SMILES | CC[C@@H](N)c1ncc(C)o1 |
| InChI | InChI=1S/C7H12N2O/c1-3-6(8)7-9-4-5(2)10-7/h4,6H,3,8H2,1-2H3/t6-/m1/s1 |
| InChIKey | SNQYZQOMGOKLTK-ZCFIWIBFSA-N |
| XLogP | 1.39 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |