C16H22N2 — CID 96674667
N-[3-(4,7-dimethyl-1H-indol-3-yl)propyl]cyclopropanamine (PubChem CID 96674667) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is N-[3-(4,7-dimethyl-1H-indol-3-yl)propyl]cyclopropanamine.
| Compound Name | N-[3-(4,7-dimethyl-1H-indol-3-yl)propyl]cyclopropanamine |
|---|---|
| PubChem CID | 96674667 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | N-[3-(4,7-dimethyl-1H-indol-3-yl)propyl]cyclopropanamine |
| SMILES | Cc1ccc(C)c2c(CCCNC3CC3)c[nH]c12 |
| InChI | InChI=1S/C16H22N2/c1-11-5-6-12(2)16-15(11)13(10-18-16)4-3-9-17-14-7-8-14/h5-6,10,14,17-18H,3-4,7-9H2,1-2H3 |
| InChIKey | SPEMURBTUTWZCV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|