C17H24N2O — CID 96679696
3-(6-methoxy-8-methyl-1,2,3,4-tetrahydrocarbazol-9-yl)propan-1-amine (PubChem CID 96679696) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 3-(6-methoxy-8-methyl-1,2,3,4-tetrahydrocarbazol-9-yl)propan-1-amine.
| Compound Name | 3-(6-methoxy-8-methyl-1,2,3,4-tetrahydrocarbazol-9-yl)propan-1-amine |
|---|---|
| PubChem CID | 96679696 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 3-(6-methoxy-8-methyl-1,2,3,4-tetrahydrocarbazol-9-yl)propan-1-amine |
| SMILES | COc1cc(C)c2c(c1)c1c(n2CCCN)CCCC1 |
| InChI | InChI=1S/C17H24N2O/c1-12-10-13(20-2)11-15-14-6-3-4-7-16(14)19(17(12)15)9-5-8-18/h10-11H,3-9,18H2,1-2H3 |
| InChIKey | HJGNYJMVDVUEFZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|