C16H22N2O — CID 84742504
6-methoxy-3,3,8,9-tetramethyl-2,4-dihydro-1H-pyrido[3,4-b]indole (PubChem CID 84742504) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 6-methoxy-3,3,8,9-tetramethyl-2,4-dihydro-1H-pyrido[3,4-b]indole.
| Compound Name | 6-methoxy-3,3,8,9-tetramethyl-2,4-dihydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 84742504 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 6-methoxy-3,3,8,9-tetramethyl-2,4-dihydro-1H-pyrido[3,4-b]indole |
| SMILES | COc1cc(C)c2c(c1)c1c(n2C)CNC(C)(C)C1 |
| InChI | InChI=1S/C16H22N2O/c1-10-6-11(19-5)7-12-13-8-16(2,3)17-9-14(13)18(4)15(10)12/h6-7,17H,8-9H2,1-5H3 |
| InChIKey | UYKLZFKCNAXUKC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|