C15H22N2O — CID 84632481
2-(5-methoxy-1,3,7-trimethylindol-2-yl)propan-2-amine (PubChem CID 84632481) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-(5-methoxy-1,3,7-trimethylindol-2-yl)propan-2-amine.
| Compound Name | 2-(5-methoxy-1,3,7-trimethylindol-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 84632481 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 2-(5-methoxy-1,3,7-trimethylindol-2-yl)propan-2-amine |
| SMILES | COc1cc(C)c2c(c1)c(C)c(C(C)(C)N)n2C |
| InChI | InChI=1S/C15H22N2O/c1-9-7-11(18-6)8-12-10(2)14(15(3,4)16)17(5)13(9)12/h7-8H,16H2,1-6H3 |
| InChIKey | JQFUGETVHHHYBL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |