C15H22N2 — CID 84626410
2-(1,3,4,6-tetramethylindol-2-yl)propan-2-amine (PubChem CID 84626410) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-(1,3,4,6-tetramethylindol-2-yl)propan-2-amine.
| Compound Name | 2-(1,3,4,6-tetramethylindol-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 84626410 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2-(1,3,4,6-tetramethylindol-2-yl)propan-2-amine |
| SMILES | Cc1cc(C)c2c(C)c(C(C)(C)N)n(C)c2c1 |
| InChI | InChI=1S/C15H22N2/c1-9-7-10(2)13-11(3)14(15(4,5)16)17(6)12(13)8-9/h7-8H,16H2,1-6H3 |
| InChIKey | NSHFERDAELIQHG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |