C16H16N2O3S — CID 96695092
3-[2-oxo-2-(3-oxo-4-prop-2-enyl-1,4-benzoxazin-6-yl)ethyl]sulfanylpropanenitrile (PubChem CID 96695092) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is 3-[2-oxo-2-(3-oxo-4-prop-2-enyl-1,4-benzoxazin-6-yl)ethyl]sulfanylpropanenitrile.
| Compound Name | 3-[2-oxo-2-(3-oxo-4-prop-2-enyl-1,4-benzoxazin-6-yl)ethyl]sulfanylpropanenitrile |
|---|---|
| PubChem CID | 96695092 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 3-[2-oxo-2-(3-oxo-4-prop-2-enyl-1,4-benzoxazin-6-yl)ethyl]sulfanylpropanenitrile |
| SMILES | C=CCN1C(=O)COc2ccc(C(=O)CSCCC#N)cc21 |
| InChI | InChI=1S/C16H16N2O3S/c1-2-7-18-13-9-12(14(19)11-22-8-3-6-17)4-5-15(13)21-10-16(18)20/h2,4-5,9H,1,3,7-8,10-11H2 |
| InChIKey | YVGHNEJHBZEBOV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|