C15H17N3O2S — CID 968305
2-(2-methoxyanilino)-N-[(5-methylthiophen-2-yl)methylideneamino]acetamide (PubChem CID 968305) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 2-(2-methoxyanilino)-N-[(5-methylthiophen-2-yl)methylideneamino]acetamide.
| Compound Name | 2-(2-methoxyanilino)-N-[(5-methylthiophen-2-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 968305 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-(2-methoxyanilino)-N-[(5-methylthiophen-2-yl)methylideneamino]acetamide |
| SMILES | COc1ccccc1NCC(=O)NN=Cc1ccc(C)s1 |
| InChI | InChI=1S/C15H17N3O2S/c1-11-7-8-12(21-11)9-17-18-15(19)10-16-13-5-3-4-6-14(13)20-2/h3-9,16H,10H2,1-2H3,(H,18,19) |
| InChIKey | PCXWWVTXXMZHAD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|