C18H20BrNO3S — CID 97016298
phenyl 2-[(2R)-2-(4-bromophenyl)pyrrolidin-1-yl]ethanesulfonate (PubChem CID 97016298) has the molecular formula C18H20BrNO3S and a molecular weight of 410.33 g/mol. Its IUPAC name is phenyl 2-[(2R)-2-(4-bromophenyl)pyrrolidin-1-yl]ethanesulfonate.
| Compound Name | phenyl 2-[(2R)-2-(4-bromophenyl)pyrrolidin-1-yl]ethanesulfonate |
|---|---|
| PubChem CID | 97016298 |
| Molecular Formula | C18H20BrNO3S |
| Molecular Weight | 410.33 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | phenyl 2-[(2R)-2-(4-bromophenyl)pyrrolidin-1-yl]ethanesulfonate |
| SMILES | O=S(=O)(CCN1CCC[C@@H]1c1ccc(Br)cc1)Oc1ccccc1 |
| InChI | InChI=1S/C18H20BrNO3S/c19-16-10-8-15(9-11-16)18-7-4-12-20(18)13-14-24(21,22)23-17-5-2-1-3-6-17/h1-3,5-6,8-11,18H,4,7,12-14H2/t18-/m1/s1 |
| InChIKey | SMONARLIVHPPMK-GOSISDBHSA-N |
| XLogP | 3.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|