C20H20N2O5 — CID 97016479
2-[(3S)-5-oxooxolan-3-yl]-N'-[2-(2-phenylphenoxy)acetyl]acetohydrazide (PubChem CID 97016479) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is 2-[(3S)-5-oxooxolan-3-yl]-N'-[2-(2-phenylphenoxy)acetyl]acetohydrazide.
| Compound Name | 2-[(3S)-5-oxooxolan-3-yl]-N'-[2-(2-phenylphenoxy)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 97016479 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 2-[(3S)-5-oxooxolan-3-yl]-N'-[2-(2-phenylphenoxy)acetyl]acetohydrazide |
| SMILES | O=C(COc1ccccc1-c1ccccc1)NNC(=O)C[C@@H]1COC(=O)C1 |
| InChI | InChI=1S/C20H20N2O5/c23-18(10-14-11-20(25)27-12-14)21-22-19(24)13-26-17-9-5-4-8-16(17)15-6-2-1-3-7-15/h1-9,14H,10-13H2,(H,21,23)(H,22,24)/t14-/m0/s1 |
| InChIKey | MDFZVUNXFACFDN-AWEZNQCLSA-N |
| XLogP | 1.83 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|