C20H24N2O3S — CID 97018062
N-[(3R,4R)-1,1-dioxo-4-pyrrolidin-1-ylthiolan-3-yl]-2-naphthalen-2-ylacetamide (PubChem CID 97018062) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is N-[(3R,4R)-1,1-dioxo-4-pyrrolidin-1-ylthiolan-3-yl]-2-naphthalen-2-ylacetamide.
| Compound Name | N-[(3R,4R)-1,1-dioxo-4-pyrrolidin-1-ylthiolan-3-yl]-2-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 97018062 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | N-[(3R,4R)-1,1-dioxo-4-pyrrolidin-1-ylthiolan-3-yl]-2-naphthalen-2-ylacetamide |
| SMILES | O=C(Cc1ccc2ccccc2c1)N[C@H]1CS(=O)(=O)C[C@@H]1N1CCCC1 |
| InChI | InChI=1S/C20H24N2O3S/c23-20(12-15-7-8-16-5-1-2-6-17(16)11-15)21-18-13-26(24,25)14-19(18)22-9-3-4-10-22/h1-2,5-8,11,18-19H,3-4,9-10,12-14H2,(H,21,23)/t18-,19-/m0/s1 |
| InChIKey | IMGLEOFKGXEBLT-OALUTQOASA-N |
| XLogP | 1.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |