C21H29N3O3S — CID 52523504
N-[(3S,4R)-1,1-dioxo-4-piperidin-1-ylthiolan-3-yl]-4-(1H-indol-3-yl)butanamide (PubChem CID 52523504) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is N-[(3S,4R)-1,1-dioxo-4-piperidin-1-ylthiolan-3-yl]-4-(1H-indol-3-yl)butanamide.
| Compound Name | N-[(3S,4R)-1,1-dioxo-4-piperidin-1-ylthiolan-3-yl]-4-(1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 52523504 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-[(3S,4R)-1,1-dioxo-4-piperidin-1-ylthiolan-3-yl]-4-(1H-indol-3-yl)butanamide |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)N[C@@H]1CS(=O)(=O)C[C@@H]1N1CCCCC1 |
| InChI | InChI=1S/C21H29N3O3S/c25-21(10-6-7-16-13-22-18-9-3-2-8-17(16)18)23-19-14-28(26,27)15-20(19)24-11-4-1-5-12-24/h2-3,8-9,13,19-20,22H,1,4-7,10-12,14-15H2,(H,23,25)/t19-,20+/m1/s1 |
| InChIKey | GZPQSGRWMKCKEM-UXHICEINSA-N |
| XLogP | 2.26 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |