C15H20F3N3O2 — CID 97018370
N,N-bis[[(2R)-oxolan-2-yl]methyl]-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 97018370) has the molecular formula C15H20F3N3O2 and a molecular weight of 331.34 g/mol. Its IUPAC name is N,N-bis[[(2R)-oxolan-2-yl]methyl]-4-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N,N-bis[[(2R)-oxolan-2-yl]methyl]-4-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 97018370 |
| Molecular Formula | C15H20F3N3O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N,N-bis[[(2R)-oxolan-2-yl]methyl]-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | FC(F)(F)c1ccnc(N(C[C@H]2CCCO2)C[C@H]2CCCO2)n1 |
| InChI | InChI=1S/C15H20F3N3O2/c16-15(17,18)13-5-6-19-14(20-13)21(9-11-3-1-7-22-11)10-12-4-2-8-23-12/h5-6,11-12H,1-4,7-10H2/t11-,12-/m1/s1 |
| InChIKey | DYCKMWYECSLVKX-VXGBXAGGSA-N |
| XLogP | 2.66 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |