C16H25N3O2 — CID 95895732
4-[(2S)-2-(4-methylpyrimidin-2-yl)oxyhex-5-enyl]-1,4-oxazepane (PubChem CID 95895732) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is 4-[(2S)-2-(4-methylpyrimidin-2-yl)oxyhex-5-enyl]-1,4-oxazepane.
| Compound Name | 4-[(2S)-2-(4-methylpyrimidin-2-yl)oxyhex-5-enyl]-1,4-oxazepane |
|---|---|
| PubChem CID | 95895732 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 4-[(2S)-2-(4-methylpyrimidin-2-yl)oxyhex-5-enyl]-1,4-oxazepane |
| SMILES | C=CCC[C@@H](CN1CCCOCC1)Oc1nccc(C)n1 |
| InChI | InChI=1S/C16H25N3O2/c1-3-4-6-15(13-19-9-5-11-20-12-10-19)21-16-17-8-7-14(2)18-16/h3,7-8,15H,1,4-6,9-13H2,2H3/t15-/m0/s1 |
| InChIKey | GWZLXTSMPXUPAJ-HNNXBMFYSA-N |
| XLogP | 2.22 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|