C14H17N3O2S2 — CID 97018585
(4aS,8aS)-1-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine (PubChem CID 97018585) has the molecular formula C14H17N3O2S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is (4aS,8aS)-1-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine.
| Compound Name | (4aS,8aS)-1-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine |
|---|---|
| PubChem CID | 97018585 |
| Molecular Formula | C14H17N3O2S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (4aS,8aS)-1-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine |
| SMILES | c1cc(-c2nc(CN3CCS[C@@H]4COCC[C@@H]43)no2)cs1 |
| InChI | InChI=1S/C14H17N3O2S2/c1-4-18-8-12-11(1)17(3-6-21-12)7-13-15-14(19-16-13)10-2-5-20-9-10/h2,5,9,11-12H,1,3-4,6-8H2/t11-,12+/m0/s1 |
| InChIKey | TVNXGPWXYYYRPN-NWDGAFQWSA-N |
| XLogP | 2.50 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |