C19H32N4 — CID 97022640
(2S)-2-[[4-(4-propan-2-ylcyclohexyl)piperazin-1-yl]methyl]pentanedinitrile (PubChem CID 97022640) has the molecular formula C19H32N4 and a molecular weight of 316.49 g/mol. Its IUPAC name is (2S)-2-[[4-(4-propan-2-ylcyclohexyl)piperazin-1-yl]methyl]pentanedinitrile.
| Compound Name | (2S)-2-[[4-(4-propan-2-ylcyclohexyl)piperazin-1-yl]methyl]pentanedinitrile |
|---|---|
| PubChem CID | 97022640 |
| Molecular Formula | C19H32N4 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | (2S)-2-[[4-(4-propan-2-ylcyclohexyl)piperazin-1-yl]methyl]pentanedinitrile |
| SMILES | CC(C)C1CCC(N2CCN(C[C@@H](C#N)CCC#N)CC2)CC1 |
| InChI | InChI=1S/C19H32N4/c1-16(2)18-5-7-19(8-6-18)23-12-10-22(11-13-23)15-17(14-21)4-3-9-20/h16-19H,3-8,10-13,15H2,1-2H3/t17-,18?,19?/m1/s1 |
| InChIKey | RIEJENHNVMUYKK-LMDPOFIKSA-N |
| XLogP | 3.26 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |