C20H33N3 — CID 97023531
1-[3-(2-methylphenyl)propyl]-4-[(3S)-1-methylpiperidin-3-yl]piperazine (PubChem CID 97023531) has the molecular formula C20H33N3 and a molecular weight of 315.50 g/mol. Its IUPAC name is 1-[3-(2-methylphenyl)propyl]-4-[(3S)-1-methylpiperidin-3-yl]piperazine.
| Compound Name | 1-[3-(2-methylphenyl)propyl]-4-[(3S)-1-methylpiperidin-3-yl]piperazine |
|---|---|
| PubChem CID | 97023531 |
| Molecular Formula | C20H33N3 |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.27 |
| IUPAC Name | 1-[3-(2-methylphenyl)propyl]-4-[(3S)-1-methylpiperidin-3-yl]piperazine |
| SMILES | Cc1ccccc1CCCN1CCN([C@H]2CCCN(C)C2)CC1 |
| InChI | InChI=1S/C20H33N3/c1-18-7-3-4-8-19(18)9-5-12-22-13-15-23(16-14-22)20-10-6-11-21(2)17-20/h3-4,7-8,20H,5-6,9-17H2,1-2H3/t20-/m0/s1 |
| InChIKey | PINOKWHZEUKOJE-FQEVSTJZSA-N |
| XLogP | 2.64 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |