C17H27NO5S — CID 97029132
ethyl 4-[[(2R,4S)-4-hydroxy-2-phenylpentyl]sulfamoyl]butanoate (PubChem CID 97029132) has the molecular formula C17H27NO5S and a molecular weight of 357.47 g/mol. Its IUPAC name is ethyl 4-[[(2R,4S)-4-hydroxy-2-phenylpentyl]sulfamoyl]butanoate.
| Compound Name | ethyl 4-[[(2R,4S)-4-hydroxy-2-phenylpentyl]sulfamoyl]butanoate |
|---|---|
| PubChem CID | 97029132 |
| Molecular Formula | C17H27NO5S |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | ethyl 4-[[(2R,4S)-4-hydroxy-2-phenylpentyl]sulfamoyl]butanoate |
| SMILES | CCOC(=O)CCCS(=O)(=O)NC[C@H](C[C@H](C)O)c1ccccc1 |
| InChI | InChI=1S/C17H27NO5S/c1-3-23-17(20)10-7-11-24(21,22)18-13-16(12-14(2)19)15-8-5-4-6-9-15/h4-6,8-9,14,16,18-19H,3,7,10-13H2,1-2H3/t14-,16-/m0/s1 |
| InChIKey | SQACHUYQTUILNF-HOCLYGCPSA-N |
| XLogP | 1.80 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |