C13H19NO3 — CID 97036385
methyl (1R,4S)-4-carbamoyl-2,2-dimethyl-3-methylidenebicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 97036385) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is methyl (1R,4S)-4-carbamoyl-2,2-dimethyl-3-methylidenebicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | methyl (1R,4S)-4-carbamoyl-2,2-dimethyl-3-methylidenebicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 97036385 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | methyl (1R,4S)-4-carbamoyl-2,2-dimethyl-3-methylidenebicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | C=C1C(C)(C)[C@@]2(C(=O)OC)CC[C@]1(C(N)=O)C2 |
| InChI | InChI=1S/C13H19NO3/c1-8-11(2,3)13(10(16)17-4)6-5-12(8,7-13)9(14)15/h1,5-7H2,2-4H3,(H2,14,15)/t12-,13-/m0/s1 |
| InChIKey | XEESCGPKDXISPX-STQMWFEESA-N |
| XLogP | 1.40 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|