C5H7IN4S — CID 97046704
5-iodo-2-methylsulfanylpyrimidine-4,6-diamine (PubChem CID 97046704) has the molecular formula C5H7IN4S and a molecular weight of 282.11 g/mol. Its IUPAC name is 5-iodo-2-methylsulfanylpyrimidine-4,6-diamine.
| Compound Name | 5-iodo-2-methylsulfanylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 97046704 |
| Molecular Formula | C5H7IN4S |
| Molecular Weight | 282.11 g/mol |
| Exact Mass | 281.94 |
| IUPAC Name | 5-iodo-2-methylsulfanylpyrimidine-4,6-diamine |
| SMILES | CSc1nc(N)c(I)c(N)n1 |
| InChI | InChI=1S/C5H7IN4S/c1-11-5-9-3(7)2(6)4(8)10-5/h1H3,(H4,7,8,9,10) |
| InChIKey | UGHMJPIINUNWIA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.11 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|