C13H24O3 — CID 97050396
(4S)-4-ethyl-4-hydroxyundecane-3,5-dione (PubChem CID 97050396) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is (4S)-4-ethyl-4-hydroxyundecane-3,5-dione.
| Compound Name | (4S)-4-ethyl-4-hydroxyundecane-3,5-dione |
|---|---|
| PubChem CID | 97050396 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (4S)-4-ethyl-4-hydroxyundecane-3,5-dione |
| SMILES | CCCCCCC(=O)[C@](O)(CC)C(=O)CC |
| InChI | InChI=1S/C13H24O3/c1-4-7-8-9-10-12(15)13(16,6-3)11(14)5-2/h16H,4-10H2,1-3H3/t13-/m0/s1 |
| InChIKey | DGXXQQYSQHIQMT-ZDUSSCGKSA-N |
| XLogP | 2.65 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|