C11H21NO3 — CID 124639866
(4S)-9-amino-4-ethyl-4-hydroxynonane-3,5-dione (PubChem CID 124639866) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is (4S)-9-amino-4-ethyl-4-hydroxynonane-3,5-dione.
| Compound Name | (4S)-9-amino-4-ethyl-4-hydroxynonane-3,5-dione |
|---|---|
| PubChem CID | 124639866 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | (4S)-9-amino-4-ethyl-4-hydroxynonane-3,5-dione |
| SMILES | CCC(=O)[C@@](O)(CC)C(=O)CCCCN |
| InChI | InChI=1S/C11H21NO3/c1-3-9(13)11(15,4-2)10(14)7-5-6-8-12/h15H,3-8,12H2,1-2H3/t11-/m0/s1 |
| InChIKey | YXHIUVHYTHGEDN-NSHDSACASA-N |
| XLogP | 0.80 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|