C13H21NO — CID 97057919
(2R)-1-[(2,4-dimethylphenyl)methoxy]butan-2-amine (PubChem CID 97057919) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (2R)-1-[(2,4-dimethylphenyl)methoxy]butan-2-amine.
| Compound Name | (2R)-1-[(2,4-dimethylphenyl)methoxy]butan-2-amine |
|---|---|
| PubChem CID | 97057919 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (2R)-1-[(2,4-dimethylphenyl)methoxy]butan-2-amine |
| SMILES | CC[C@@H](N)COCc1ccc(C)cc1C |
| InChI | InChI=1S/C13H21NO/c1-4-13(14)9-15-8-12-6-5-10(2)7-11(12)3/h5-7,13H,4,8-9,14H2,1-3H3/t13-/m1/s1 |
| InChIKey | CZAJUSFQOKGGJM-CYBMUJFWSA-N |
| XLogP | 2.56 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |