C17H17F3N2O2 — CID 97061302
methyl (2R)-2-[methyl(2-pyridin-4-ylethyl)amino]-2-(3,4,5-trifluorophenyl)acetate (PubChem CID 97061302) has the molecular formula C17H17F3N2O2 and a molecular weight of 338.33 g/mol. Its IUPAC name is methyl (2R)-2-[methyl(2-pyridin-4-ylethyl)amino]-2-(3,4,5-trifluorophenyl)acetate.
| Compound Name | methyl (2R)-2-[methyl(2-pyridin-4-ylethyl)amino]-2-(3,4,5-trifluorophenyl)acetate |
|---|---|
| PubChem CID | 97061302 |
| Molecular Formula | C17H17F3N2O2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | methyl (2R)-2-[methyl(2-pyridin-4-ylethyl)amino]-2-(3,4,5-trifluorophenyl)acetate |
| SMILES | COC(=O)[C@@H](c1cc(F)c(F)c(F)c1)N(C)CCc1ccncc1 |
| InChI | InChI=1S/C17H17F3N2O2/c1-22(8-5-11-3-6-21-7-4-11)16(17(23)24-2)12-9-13(18)15(20)14(19)10-12/h3-4,6-7,9-10,16H,5,8H2,1-2H3/t16-/m1/s1 |
| InChIKey | WPSNMGBPPSDFFD-MRXNPFEDSA-N |
| XLogP | 2.89 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|