C22H22ClN3O4 — CID 97063780
N-[(3R)-1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide (PubChem CID 97063780) has the molecular formula C22H22ClN3O4 and a molecular weight of 427.89 g/mol. Its IUPAC name is N-[(3R)-1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[(3R)-1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 97063780 |
| Molecular Formula | C22H22ClN3O4 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | N-[(3R)-1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide |
| SMILES | COc1ccc(Cl)cc1N1CC[C@@H](NC(=O)c2cccc(N3C(=O)CCC3=O)c2)C1 |
| InChI | InChI=1S/C22H22ClN3O4/c1-30-19-6-5-15(23)12-18(19)25-10-9-16(13-25)24-22(29)14-3-2-4-17(11-14)26-20(27)7-8-21(26)28/h2-6,11-12,16H,7-10,13H2,1H3,(H,24,29)/t16-/m1/s1 |
| InChIKey | ZZHBGMWMLSOKHQ-MRXNPFEDSA-N |
| XLogP | 3.01 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|